C24H23N3O4S — CID 22782384
N-[4-[1-(3,5-dimethylanilino)-1-oxopropan-2-yl]sulfanylphenyl]-3-nitrobenzamide (PubChem CID 22782384) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[4-[1-(3,5-dimethylanilino)-1-oxopropan-2-yl]sulfanylphenyl]-3-nitrobenzamide.
| Compound Name | N-[4-[1-(3,5-dimethylanilino)-1-oxopropan-2-yl]sulfanylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 22782384 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[4-[1-(3,5-dimethylanilino)-1-oxopropan-2-yl]sulfanylphenyl]-3-nitrobenzamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(C)Sc2ccc(NC(=O)c3cccc([N+](=O)[O-])c3)cc2)c1 |
| InChI | InChI=1S/C24H23N3O4S/c1-15-11-16(2)13-20(12-15)26-23(28)17(3)32-22-9-7-19(8-10-22)25-24(29)18-5-4-6-21(14-18)27(30)31/h4-14,17H,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | IIKAGXZGZVGOHW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|