C29H25N3O4S — CID 23101156
N-[4-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 23101156) has the molecular formula C29H25N3O4S and a molecular weight of 511.60 g/mol. Its IUPAC name is N-[4-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[4-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 23101156 |
| Molecular Formula | C29H25N3O4S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | N-[4-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(Sc2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C29H25N3O4S/c1-19-16-20(2)18-24(17-19)31-29(34)27(21-6-4-3-5-7-21)37-26-14-10-23(11-15-26)30-28(33)22-8-12-25(13-9-22)32(35)36/h3-18,27H,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | UBCBEQCZSHUMSV-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|