C29H23N3O6S — CID 21169045
N-[4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 21169045) has the molecular formula C29H23N3O6S and a molecular weight of 541.59 g/mol. Its IUPAC name is N-[4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 21169045 |
| Molecular Formula | C29H23N3O6S |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | N-[4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc3c(c2)OCCO3)c2ccccc2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H23N3O6S/c33-28(20-6-11-23(12-7-20)32(35)36)30-21-8-13-24(14-9-21)39-27(19-4-2-1-3-5-19)29(34)31-22-10-15-25-26(18-22)38-17-16-37-25/h1-15,18,27H,16-17H2,(H,30,33)(H,31,34) |
| InChIKey | HGSIHYAGHLYQCT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|