C28H22ClN3O4S — CID 21168422
N-[4-[2-(3-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 21168422) has the molecular formula C28H22ClN3O4S and a molecular weight of 532.02 g/mol. Its IUPAC name is N-[4-[2-(3-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[4-[2-(3-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 21168422 |
| Molecular Formula | C28H22ClN3O4S |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | N-[4-[2-(3-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(Sc1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H22ClN3O4S/c1-18-24(29)8-5-9-25(18)31-28(34)26(19-6-3-2-4-7-19)37-23-16-12-21(13-17-23)30-27(33)20-10-14-22(15-11-20)32(35)36/h2-17,26H,1H3,(H,30,33)(H,31,34) |
| InChIKey | RYYYLGUYNCTQED-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|