C22H18ClN3O4S — CID 23094873
N-[4-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 23094873) has the molecular formula C22H18ClN3O4S and a molecular weight of 455.92 g/mol. Its IUPAC name is N-[4-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[4-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 23094873 |
| Molecular Formula | C22H18ClN3O4S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-[4-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CSc1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H18ClN3O4S/c1-14-19(23)3-2-4-20(14)25-21(27)13-31-18-11-7-16(8-12-18)24-22(28)15-5-9-17(10-6-15)26(29)30/h2-12H,13H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | RWXFYAUXAZWWFK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|