C26H23N5O5S — CID 21167259
N-[4-[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 21167259) has the molecular formula C26H23N5O5S and a molecular weight of 517.57 g/mol. Its IUPAC name is N-[4-[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[4-[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 21167259 |
| Molecular Formula | C26H23N5O5S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | N-[4-[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | Cc1c(NC(=O)CSc2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C26H23N5O5S/c1-17-24(26(34)30(29(17)2)20-6-4-3-5-7-20)28-23(32)16-37-22-14-10-19(11-15-22)27-25(33)18-8-12-21(13-9-18)31(35)36/h3-15H,16H2,1-2H3,(H,27,33)(H,28,32) |
| InChIKey | CCHVSPFJUZLJHD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|