C21H17N3O4S — CID 18905322
N-[3-(2-anilino-2-oxoethyl)sulfanylphenyl]-4-nitrobenzamide (PubChem CID 18905322) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is N-[3-(2-anilino-2-oxoethyl)sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-(2-anilino-2-oxoethyl)sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 18905322 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[3-(2-anilino-2-oxoethyl)sulfanylphenyl]-4-nitrobenzamide |
| SMILES | O=C(CSc1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2)c1)Nc1ccccc1 |
| InChI | InChI=1S/C21H17N3O4S/c25-20(22-16-5-2-1-3-6-16)14-29-19-8-4-7-17(13-19)23-21(26)15-9-11-18(12-10-15)24(27)28/h1-13H,14H2,(H,22,25)(H,23,26) |
| InChIKey | ITFNFUJDLJOHDF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|