C22H18ClN3O5S — CID 18905380
N-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 18905380) has the molecular formula C22H18ClN3O5S and a molecular weight of 471.92 g/mol. Its IUPAC name is N-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 18905380 |
| Molecular Formula | C22H18ClN3O5S |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | N-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | COc1ccc(NC(=O)CSc2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)cc1Cl |
| InChI | InChI=1S/C22H18ClN3O5S/c1-31-20-10-7-16(12-19(20)23)24-21(27)13-32-18-4-2-3-15(11-18)25-22(28)14-5-8-17(9-6-14)26(29)30/h2-12H,13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | RIBKXYINXWRRJL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|