C21H13F4N3O4S — CID 18905384
4-nitro-N-[3-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]benzamide (PubChem CID 18905384) has the molecular formula C21H13F4N3O4S and a molecular weight of 479.41 g/mol. Its IUPAC name is 4-nitro-N-[3-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]benzamide.
| Compound Name | 4-nitro-N-[3-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18905384 |
| Molecular Formula | C21H13F4N3O4S |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 4-nitro-N-[3-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2)c1)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C21H13F4N3O4S/c22-15-9-16(23)19(25)20(18(15)24)27-17(29)10-33-14-3-1-2-12(8-14)26-21(30)11-4-6-13(7-5-11)28(31)32/h1-9H,10H2,(H,26,30)(H,27,29) |
| InChIKey | YGODSUADGBVQPP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|