C21H15FN2O4S — CID 19299596
4-fluoro-N-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylphenyl]benzamide (PubChem CID 19299596) has the molecular formula C21H15FN2O4S and a molecular weight of 410.43 g/mol. Its IUPAC name is 4-fluoro-N-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 19299596 |
| Molecular Formula | C21H15FN2O4S |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 4-fluoro-N-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)c2ccc(F)cc2)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H15FN2O4S/c22-16-9-7-14(8-10-16)21(26)23-17-4-2-6-19(12-17)29-13-20(25)15-3-1-5-18(11-15)24(27)28/h1-12H,13H2,(H,23,26) |
| InChIKey | XKBCFEPWVRTDJO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|