C22H18N2O4S — CID 19299704
N-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide (PubChem CID 19299704) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide.
| Compound Name | N-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 19299704 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1cccc(SCC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C22H18N2O4S/c25-21(17-8-4-10-19(13-17)24(27)28)15-29-20-11-5-9-18(14-20)23-22(26)12-16-6-2-1-3-7-16/h1-11,13-14H,12,15H2,(H,23,26) |
| InChIKey | JRZPWCASEMJTAD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|