C27H17F4N3O4S — CID 18905528
4-nitro-N-[3-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]benzamide (PubChem CID 18905528) has the molecular formula C27H17F4N3O4S and a molecular weight of 555.51 g/mol. Its IUPAC name is 4-nitro-N-[3-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]benzamide.
| Compound Name | 4-nitro-N-[3-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18905528 |
| Molecular Formula | C27H17F4N3O4S |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | 4-nitro-N-[3-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2c(F)c(F)cc(F)c2F)c2ccccc2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H17F4N3O4S/c28-20-14-21(29)23(31)24(22(20)30)33-27(36)25(15-5-2-1-3-6-15)39-19-8-4-7-17(13-19)32-26(35)16-9-11-18(12-10-16)34(37)38/h1-14,25H,(H,32,35)(H,33,36) |
| InChIKey | MRLVSLVKDWNFEL-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|