C22H13Cl4N3O6S — CID 18895925
2,3,4,5-tetrachloro-6-[[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895925) has the molecular formula C22H13Cl4N3O6S and a molecular weight of 589.24 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895925 |
| Molecular Formula | C22H13Cl4N3O6S |
| Molecular Weight | 589.24 g/mol |
| Exact Mass | 586.93 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | O=C(CSc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H13Cl4N3O6S/c23-17-15(16(22(32)33)18(24)20(26)19(17)25)21(31)28-11-2-1-3-13(8-11)36-9-14(30)27-10-4-6-12(7-5-10)29(34)35/h1-8H,9H2,(H,27,30)(H,28,31)(H,32,33) |
| InChIKey | VJLKAQCWSQUTQR-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.24 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|