C23H9Cl4F7N2O4S — CID 18895965
2,3,4,5-tetrachloro-6-[[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895965) has the molecular formula C23H9Cl4F7N2O4S and a molecular weight of 684.20 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895965 |
| Molecular Formula | C23H9Cl4F7N2O4S |
| Molecular Weight | 684.20 g/mol |
| Exact Mass | 681.89 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | O=C(CSc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C23H9Cl4F7N2O4S/c24-12-9(10(22(39)40)13(25)15(27)14(12)26)21(38)35-6-2-1-3-7(4-6)41-5-8(37)36-20-18(30)16(28)11(23(32,33)34)17(29)19(20)31/h1-4H,5H2,(H,35,38)(H,36,37)(H,39,40) |
| InChIKey | JEMHPHIRIVOXDD-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.20 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|