C27H22Cl4N2O6S2 — CID 18897728
2,3,4,5-tetrachloro-6-[[3-[2-[(3-methoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18897728) has the molecular formula C27H22Cl4N2O6S2 and a molecular weight of 676.43 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-[(3-methoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-[(3-methoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18897728 |
| Molecular Formula | C27H22Cl4N2O6S2 |
| Molecular Weight | 676.43 g/mol |
| Exact Mass | 673.97 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-[(3-methoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | COC(=O)c1c(NC(=O)CSc2cccc(NC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C(=O)O)c2)sc2c1CCCCC2 |
| InChI | InChI=1S/C27H22Cl4N2O6S2/c1-39-27(38)17-14-8-3-2-4-9-15(14)41-25(17)33-16(34)11-40-13-7-5-6-12(10-13)32-24(35)18-19(26(36)37)21(29)23(31)22(30)20(18)28/h5-7,10H,2-4,8-9,11H2,1H3,(H,32,35)(H,33,34)(H,36,37) |
| InChIKey | FIPLWUIDRLTIRH-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.43 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|