C28H32N2O6S2 — CID 18897862
6-[[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 18897862) has the molecular formula C28H32N2O6S2 and a molecular weight of 556.71 g/mol. Its IUPAC name is 6-[[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 18897862 |
| Molecular Formula | C28H32N2O6S2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 6-[[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COC(=O)c1c(NC(=O)CSc2cccc(NC(=O)C3CC=CCC3C(=O)O)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C28H32N2O6S2/c1-36-28(35)24-21-13-4-2-3-5-14-22(21)38-26(24)30-23(31)16-37-18-10-8-9-17(15-18)29-25(32)19-11-6-7-12-20(19)27(33)34/h6-10,15,19-20H,2-5,11-14,16H2,1H3,(H,29,32)(H,30,31)(H,33,34) |
| InChIKey | ORDAOSTYGYFNNC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|