C24H33NO5S — CID 5171423
6-[(3-methoxycarbonyl-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 5171423) has the molecular formula C24H33NO5S and a molecular weight of 447.60 g/mol. Its IUPAC name is 6-[(3-methoxycarbonyl-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[(3-methoxycarbonyl-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 5171423 |
| Molecular Formula | C24H33NO5S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 6-[(3-methoxycarbonyl-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COC(=O)c1c(NC(=O)C2CC=CCC2C(=O)O)sc2c1CCCCCCCCCC2 |
| InChI | InChI=1S/C24H33NO5S/c1-30-24(29)20-18-14-8-6-4-2-3-5-7-9-15-19(18)31-22(20)25-21(26)16-12-10-11-13-17(16)23(27)28/h10-11,16-17H,2-9,12-15H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | KGXLDPOLPLEHKB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|