C20H25NO5S — CID 996434
(1R,6S)-6-[(3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 996434) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is (1R,6S)-6-[(3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-[(3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 996434 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (1R,6S)-6-[(3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | COC(=O)c1c(NC(=O)[C@H]2CC(C)=C(C)C[C@H]2C(=O)O)sc2c1CCCC2 |
| InChI | InChI=1S/C20H25NO5S/c1-10-8-13(14(19(23)24)9-11(10)2)17(22)21-18-16(20(25)26-3)12-6-4-5-7-15(12)27-18/h13-14H,4-9H2,1-3H3,(H,21,22)(H,23,24)/t13-,14+/m0/s1 |
| InChIKey | FNFQUUVVMMQRLD-UONOGXRCSA-N |
| XLogP | 3.80 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|