C20H24NO5S- — CID 4748089
6-[(3-ethoxycarbonyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 4748089) has the molecular formula C20H24NO5S- and a molecular weight of 390.48 g/mol. Its IUPAC name is 6-[(3-ethoxycarbonyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | 6-[(3-ethoxycarbonyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 4748089 |
| Molecular Formula | C20H24NO5S- |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 6-[(3-ethoxycarbonyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C2CC(C)=C(C)CC2C(=O)[O-])sc2c1CCC2 |
| InChI | InChI=1S/C20H25NO5S/c1-4-26-20(25)16-12-6-5-7-15(12)27-18(16)21-17(22)13-8-10(2)11(3)9-14(13)19(23)24/h13-14H,4-9H2,1-3H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | FELSALOMWGPMNN-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|