C10H14N2O2S — CID 82056534
ethyl 2-hydrazinyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 82056534) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is ethyl 2-hydrazinyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-hydrazinyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 82056534 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | ethyl 2-hydrazinyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NN)sc2c1CCC2 |
| InChI | InChI=1S/C10H14N2O2S/c1-2-14-10(13)8-6-4-3-5-7(6)15-9(8)12-11/h12H,2-5,11H2,1H3 |
| InChIKey | FFCTXDMNJQVWTA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|