C23H15Cl4N3O6S — CID 18895950
2,3,4,5-tetrachloro-6-[[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895950) has the molecular formula C23H15Cl4N3O6S and a molecular weight of 603.27 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895950 |
| Molecular Formula | C23H15Cl4N3O6S |
| Molecular Weight | 603.27 g/mol |
| Exact Mass | 600.94 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1 |
| InChI | InChI=1S/C23H15Cl4N3O6S/c1-10-7-12(30(35)36)5-6-14(10)29-15(31)9-37-13-4-2-3-11(8-13)28-22(32)16-17(23(33)34)19(25)21(27)20(26)18(16)24/h2-8H,9H2,1H3,(H,28,32)(H,29,31)(H,33,34) |
| InChIKey | GOJLRZKXQVNJTL-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.27 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|