C24H19N3O8S — CID 18896527
4-[[3-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid (PubChem CID 18896527) has the molecular formula C24H19N3O8S and a molecular weight of 509.50 g/mol. Its IUPAC name is 4-[[3-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[[3-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 18896527 |
| Molecular Formula | C24H19N3O8S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 4-[[3-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)CSc1cccc(NC(=O)c2ccc(C(=O)O)cc2C(=O)O)c1 |
| InChI | InChI=1S/C24H19N3O8S/c1-13-5-7-16(27(34)35)11-20(13)26-21(28)12-36-17-4-2-3-15(10-17)25-22(29)18-8-6-14(23(30)31)9-19(18)24(32)33/h2-11H,12H2,1H3,(H,25,29)(H,26,28)(H,30,31)(H,32,33) |
| InChIKey | BEJIXNOFANHNIA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 175.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|