C45H37N3O4S2 — CID 22784428
N-[(Z)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22784428) has the molecular formula C45H37N3O4S2 and a molecular weight of 747.94 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784428 |
| Molecular Formula | C45H37N3O4S2 |
| Molecular Weight | 747.94 g/mol |
| Exact Mass | 747.22 |
| IUPAC Name | N-[(Z)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1ccc(NC(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)NC(=O)c2ccccc2)cc1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C45H37N3O4S2/c1-2-40(45(51)48-38-17-9-11-19-41(38)54-42-20-12-10-18-39(42)48)53-36-27-23-34(24-28-36)46-44(50)37(47-43(49)33-15-7-4-8-16-33)29-31-21-25-35(26-22-31)52-30-32-13-5-3-6-14-32/h3-29,40H,2,30H2,1H3,(H,46,50)(H,47,49)/b37-29- |
| InChIKey | HVTAMPDREXJNSQ-GPFIVKHLSA-N |
| XLogP | 10.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.94 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|