C39H33N3O4S2 — CID 19300502
N-[(E)-1-(4-methoxyphenyl)-3-oxo-3-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19300502) has the molecular formula C39H33N3O4S2 and a molecular weight of 671.84 g/mol. Its IUPAC name is N-[(E)-1-(4-methoxyphenyl)-3-oxo-3-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(4-methoxyphenyl)-3-oxo-3-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300502 |
| Molecular Formula | C39H33N3O4S2 |
| Molecular Weight | 671.84 g/mol |
| Exact Mass | 671.19 |
| IUPAC Name | N-[(E)-1-(4-methoxyphenyl)-3-oxo-3-[3-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(OC)cc2)NC(=O)c2ccccc2)c1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C39H33N3O4S2/c1-3-34(39(45)42-32-16-7-9-18-35(32)48-36-19-10-8-17-33(36)42)47-30-15-11-14-28(25-30)40-38(44)31(24-26-20-22-29(46-2)23-21-26)41-37(43)27-12-5-4-6-13-27/h4-25,34H,3H2,1-2H3,(H,40,44)(H,41,43)/b31-24+ |
| InChIKey | LBKCEGGGSAIQNP-QFMPWRQOSA-N |
| XLogP | 8.81 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.84 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|