C30H30N2O2S — CID 18908304
N-[3-[1-oxo-1-(4-propan-2-ylanilino)butan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide (PubChem CID 18908304) has the molecular formula C30H30N2O2S and a molecular weight of 482.65 g/mol. Its IUPAC name is N-[3-[1-oxo-1-(4-propan-2-ylanilino)butan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[1-oxo-1-(4-propan-2-ylanilino)butan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18908304 |
| Molecular Formula | C30H30N2O2S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[3-[1-oxo-1-(4-propan-2-ylanilino)butan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccc3ccccc3c2)c1)C(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C30H30N2O2S/c1-4-28(30(34)31-25-16-14-21(15-17-25)20(2)3)35-27-11-7-10-26(19-27)32-29(33)24-13-12-22-8-5-6-9-23(22)18-24/h5-20,28H,4H2,1-3H3,(H,31,34)(H,32,33) |
| InChIKey | HREUFAIHGRBKGT-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |