C27H23N3O4S — CID 18908179
N-[3-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide (PubChem CID 18908179) has the molecular formula C27H23N3O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-[3-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18908179 |
| Molecular Formula | C27H23N3O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-[3-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylphenyl]naphthalene-2-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(C)Sc1cccc(NC(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C27H23N3O4S/c1-17-10-13-23(30(33)34)16-25(17)29-26(31)18(2)35-24-9-5-8-22(15-24)28-27(32)21-12-11-19-6-3-4-7-20(19)14-21/h3-16,18H,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | SPKGHSVCGGWGDZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|