C27H20Cl2N2O2 — CID 3385314
2,4-dichloro-N-[3-[(2,2-diphenylacetyl)amino]phenyl]benzamide (PubChem CID 3385314) has the molecular formula C27H20Cl2N2O2 and a molecular weight of 475.38 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[(2,2-diphenylacetyl)amino]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[(2,2-diphenylacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 3385314 |
| Molecular Formula | C27H20Cl2N2O2 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 2,4-dichloro-N-[3-[(2,2-diphenylacetyl)amino]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(NC(=O)C(c2ccccc2)c2ccccc2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H20Cl2N2O2/c28-20-14-15-23(24(29)16-20)26(32)30-21-12-7-13-22(17-21)31-27(33)25(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-17,25H,(H,30,32)(H,31,33) |
| InChIKey | JOGYSSZYGYNJIV-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |