3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride

C14H8Cl3NO2 — CID 87323399

IUPAC3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride
SMILESO=C(Cl)c1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1
InChIInChI=1S/C14H8Cl3NO2/c15-9-4-5-11(12(16)7-9)14(20)18-10-3-1-2-8(6-10)13(17)19/h1-7H,(H,18,20)
InChIKeyYISMFIYSIDLCTN-UHFFFAOYSA-N
MW328.58 g/mol
LogP4.62
Rot. Bonds3

About 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride

3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride (PubChem CID 87323399) has the molecular formula C14H8Cl3NO2 and a molecular weight of 328.58 g/mol. Its IUPAC name is 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride.

Molecular Properties

Compound Name3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride
PubChem CID87323399
Molecular FormulaC14H8Cl3NO2
Molecular Weight328.58 g/mol
Exact Mass326.96
IUPAC Name3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride
SMILESO=C(Cl)c1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1
InChIInChI=1S/C14H8Cl3NO2/c15-9-4-5-11(12(16)7-9)14(20)18-10-3-1-2-8(6-10)13(17)19/h1-7H,(H,18,20)
InChIKeyYISMFIYSIDLCTN-UHFFFAOYSA-N
XLogP4.62
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.58
LogP ≤ 54.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride?
The IUPAC name of 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride (CID 87323399) is 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride.
What is the SMILES notation for 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride?
The canonical SMILES for 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride is O=C(Cl)c1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1.
What is the InChIKey of 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride?
The InChIKey is YISMFIYSIDLCTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl3NO2/c15-9-4-5-11(12(16)7-9)14(20)18-10-3-1-2-8(6-10)13(17)19/h1-7H,(H,18,20).
What are the key properties of 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride?
3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride has a molecular weight of 328.58 g/mol, XLogP of 4.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride is sourced from PubChem (CID 87323399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).