C14H8Cl3NO2 — CID 87323399
3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride (PubChem CID 87323399) has the molecular formula C14H8Cl3NO2 and a molecular weight of 328.58 g/mol. Its IUPAC name is 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride.
| Compound Name | 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride |
|---|---|
| PubChem CID | 87323399 |
| Molecular Formula | C14H8Cl3NO2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 3-[(2,4-dichlorobenzoyl)amino]benzoyl chloride |
| SMILES | O=C(Cl)c1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H8Cl3NO2/c15-9-4-5-11(12(16)7-9)14(20)18-10-3-1-2-8(6-10)13(17)19/h1-7H,(H,18,20) |
| InChIKey | YISMFIYSIDLCTN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|