C22H16Cl3N3O2 — CID 5078107
2,4-dichloro-N-[3-[N-[(2-chlorobenzoyl)amino]-C-methylcarbonimidoyl]phenyl]benzamide (PubChem CID 5078107) has the molecular formula C22H16Cl3N3O2 and a molecular weight of 460.75 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[N-[(2-chlorobenzoyl)amino]-C-methylcarbonimidoyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[N-[(2-chlorobenzoyl)amino]-C-methylcarbonimidoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 5078107 |
| Molecular Formula | C22H16Cl3N3O2 |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 2,4-dichloro-N-[3-[N-[(2-chlorobenzoyl)amino]-C-methylcarbonimidoyl]phenyl]benzamide |
| SMILES | CC(=NNC(=O)c1ccccc1Cl)c1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C22H16Cl3N3O2/c1-13(27-28-22(30)17-7-2-3-8-19(17)24)14-5-4-6-16(11-14)26-21(29)18-10-9-15(23)12-20(18)25/h2-12H,1H3,(H,26,29)(H,28,30) |
| InChIKey | JUKMVTRGRXUQKE-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|