C23H18Cl2N4O4 — CID 6307189
N-[(Z)-1-[3-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]-3-methyl-4-nitrobenzamide (PubChem CID 6307189) has the molecular formula C23H18Cl2N4O4 and a molecular weight of 485.33 g/mol. Its IUPAC name is N-[(Z)-1-[3-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[(Z)-1-[3-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 6307189 |
| Molecular Formula | C23H18Cl2N4O4 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | N-[(Z)-1-[3-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]-3-methyl-4-nitrobenzamide |
| SMILES | C/C(=N/NC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C23H18Cl2N4O4/c1-13-10-16(6-9-21(13)29(32)33)22(30)28-27-14(2)15-4-3-5-18(11-15)26-23(31)19-8-7-17(24)12-20(19)25/h3-12H,1-2H3,(H,26,31)(H,28,30)/b27-14- |
| InChIKey | HEFTZYFCZUMYHS-VYYCAZPPSA-N |
| XLogP | 5.62 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|