C26H19Cl2N3O2 — CID 6117391
N-[(Z)-1-[3-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]naphthalene-1-carboxamide (PubChem CID 6117391) has the molecular formula C26H19Cl2N3O2 and a molecular weight of 476.36 g/mol. Its IUPAC name is N-[(Z)-1-[3-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]naphthalene-1-carboxamide.
| Compound Name | N-[(Z)-1-[3-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 6117391 |
| Molecular Formula | C26H19Cl2N3O2 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[(Z)-1-[3-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]naphthalene-1-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cccc2ccccc12)c1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C26H19Cl2N3O2/c1-16(30-31-26(33)22-11-5-7-17-6-2-3-10-21(17)22)18-8-4-9-20(14-18)29-25(32)23-13-12-19(27)15-24(23)28/h2-15H,1H3,(H,29,32)(H,31,33)/b30-16- |
| InChIKey | CIWQKGOPMOJRMW-UHBFCERESA-N |
| XLogP | 6.55 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|