C29H23Cl2N3O3 — CID 6261065
2,4-dichloro-N-[3-[(Z)-N-[(2-hydroxy-2,2-diphenylacetyl)amino]-C-methylcarbonimidoyl]phenyl]benzamide (PubChem CID 6261065) has the molecular formula C29H23Cl2N3O3 and a molecular weight of 532.43 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[(Z)-N-[(2-hydroxy-2,2-diphenylacetyl)amino]-C-methylcarbonimidoyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[(Z)-N-[(2-hydroxy-2,2-diphenylacetyl)amino]-C-methylcarbonimidoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 6261065 |
| Molecular Formula | C29H23Cl2N3O3 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | 2,4-dichloro-N-[3-[(Z)-N-[(2-hydroxy-2,2-diphenylacetyl)amino]-C-methylcarbonimidoyl]phenyl]benzamide |
| SMILES | C/C(=N/NC(=O)C(O)(c1ccccc1)c1ccccc1)c1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C29H23Cl2N3O3/c1-19(20-9-8-14-24(17-20)32-27(35)25-16-15-23(30)18-26(25)31)33-34-28(36)29(37,21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-18,37H,1H3,(H,32,35)(H,34,36)/b33-19- |
| InChIKey | FUTYCDWVGRIJQP-APTWKGOFSA-N |
| XLogP | 6.02 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|