C15H11Cl3N2O — CID 904479
2,4-dichloro-N-[1-(4-chlorophenyl)ethylideneamino]benzamide (PubChem CID 904479) has the molecular formula C15H11Cl3N2O and a molecular weight of 341.63 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(4-chlorophenyl)ethylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[1-(4-chlorophenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 904479 |
| Molecular Formula | C15H11Cl3N2O |
| Molecular Weight | 341.63 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2,4-dichloro-N-[1-(4-chlorophenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11Cl3N2O/c1-9(10-2-4-11(16)5-3-10)19-20-15(21)13-7-6-12(17)8-14(13)18/h2-8H,1H3,(H,20,21) |
| InChIKey | DMUQWWDVROCPJM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|