C20H15Cl2N3O3 — CID 27525119
N-[(E)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]furan-2-carboxamide (PubChem CID 27525119) has the molecular formula C20H15Cl2N3O3 and a molecular weight of 416.26 g/mol. Its IUPAC name is N-[(E)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 27525119 |
| Molecular Formula | C20H15Cl2N3O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[(E)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]furan-2-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccco1)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H15Cl2N3O3/c1-12(24-25-20(27)18-3-2-10-28-18)13-4-7-15(8-5-13)23-19(26)16-9-6-14(21)11-17(16)22/h2-11H,1H3,(H,23,26)(H,25,27)/b24-12+ |
| InChIKey | TZPYVHUHVUSCLO-WYMPLXKRSA-N |
| XLogP | 4.99 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|