C34H28Cl4N6O4 — CID 3404914
N,N'-bis[1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]butanediamide (PubChem CID 3404914) has the molecular formula C34H28Cl4N6O4 and a molecular weight of 726.45 g/mol. Its IUPAC name is N,N'-bis[1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]butanediamide.
| Compound Name | N,N'-bis[1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]butanediamide |
|---|---|
| PubChem CID | 3404914 |
| Molecular Formula | C34H28Cl4N6O4 |
| Molecular Weight | 726.45 g/mol |
| Exact Mass | 724.09 |
| IUPAC Name | N,N'-bis[1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]butanediamide |
| SMILES | CC(=NNC(=O)CCC(=O)NN=C(C)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C34H28Cl4N6O4/c1-19(21-3-9-25(10-4-21)39-33(47)27-13-7-23(35)17-29(27)37)41-43-31(45)15-16-32(46)44-42-20(2)22-5-11-26(12-6-22)40-34(48)28-14-8-24(36)18-30(28)38/h3-14,17-18H,15-16H2,1-2H3,(H,39,47)(H,40,48)(H,43,45)(H,44,46) |
| InChIKey | LLFFVFQUWATCGU-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.45 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|