C22H15Cl4N3O2 — CID 6177494
3,4-dichloro-N-[(Z)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]benzamide (PubChem CID 6177494) has the molecular formula C22H15Cl4N3O2 and a molecular weight of 495.19 g/mol. Its IUPAC name is 3,4-dichloro-N-[(Z)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]benzamide.
| Compound Name | 3,4-dichloro-N-[(Z)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 6177494 |
| Molecular Formula | C22H15Cl4N3O2 |
| Molecular Weight | 495.19 g/mol |
| Exact Mass | 492.99 |
| IUPAC Name | 3,4-dichloro-N-[(Z)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(Cl)c(Cl)c1)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H15Cl4N3O2/c1-12(28-29-21(30)14-4-9-18(24)20(26)10-14)13-2-6-16(7-3-13)27-22(31)17-8-5-15(23)11-19(17)25/h2-11H,1H3,(H,27,31)(H,29,30)/b28-12- |
| InChIKey | XQEOKOJURDDDHT-NVJOKUIPSA-N |
| XLogP | 6.71 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.19 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|