C19H18Cl2N2O — CID 6184678
2,4-dichloro-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]benzamide (PubChem CID 6184678) has the molecular formula C19H18Cl2N2O and a molecular weight of 361.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 6184678 |
| Molecular Formula | C19H18Cl2N2O |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(Cl)cc1Cl)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H18Cl2N2O/c1-12(14-7-6-13-4-2-3-5-15(13)10-14)22-23-19(24)17-9-8-16(20)11-18(17)21/h6-11H,2-5H2,1H3,(H,23,24)/b22-12- |
| InChIKey | UPEIIKCLIQGBJH-UUYOSTAYSA-N |
| XLogP | 5.03 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|