C22H26N2O2 — CID 133169944
4-propoxy-N-[(E)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]benzamide (PubChem CID 133169944) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-propoxy-N-[(E)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]benzamide.
| Compound Name | 4-propoxy-N-[(E)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 133169944 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-propoxy-N-[(E)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]benzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C(\C)c2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-3-14-26-21-12-10-18(11-13-21)22(25)24-23-16(2)19-9-8-17-6-4-5-7-20(17)15-19/h8-13,15H,3-7,14H2,1-2H3,(H,24,25)/b23-16+ |
| InChIKey | YMLZZTCNBMFIIU-XQNSMLJCSA-N |
| XLogP | 4.51 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|