C18H18Cl2N2O2 — CID 133169925
N-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-4-propoxybenzamide (PubChem CID 133169925) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is N-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-4-propoxybenzamide.
| Compound Name | N-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-4-propoxybenzamide |
|---|---|
| PubChem CID | 133169925 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C(\C)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-3-10-24-15-7-4-13(5-8-15)18(23)22-21-12(2)14-6-9-16(19)17(20)11-14/h4-9,11H,3,10H2,1-2H3,(H,22,23)/b21-12+ |
| InChIKey | QUMLMSKWADPDMH-CIAFOILYSA-N |
| XLogP | 4.94 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|