C20H18Cl4N4O2 — CID 3636545
N,N'-bis[1-(3,4-dichlorophenyl)ethylideneamino]butanediamide (PubChem CID 3636545) has the molecular formula C20H18Cl4N4O2 and a molecular weight of 488.20 g/mol. Its IUPAC name is N,N'-bis[1-(3,4-dichlorophenyl)ethylideneamino]butanediamide.
| Compound Name | N,N'-bis[1-(3,4-dichlorophenyl)ethylideneamino]butanediamide |
|---|---|
| PubChem CID | 3636545 |
| Molecular Formula | C20H18Cl4N4O2 |
| Molecular Weight | 488.20 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | N,N'-bis[1-(3,4-dichlorophenyl)ethylideneamino]butanediamide |
| SMILES | CC(=NNC(=O)CCC(=O)NN=C(C)c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H18Cl4N4O2/c1-11(13-3-5-15(21)17(23)9-13)25-27-19(29)7-8-20(30)28-26-12(2)14-4-6-16(22)18(24)10-14/h3-6,9-10H,7-8H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | XUJAXNSMVMHTBC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.20 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|