C17H17Cl2N3O2 — CID 7933131
N-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-2-(4-methoxyanilino)acetamide (PubChem CID 7933131) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-2-(4-methoxyanilino)acetamide.
| Compound Name | N-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-2-(4-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 7933131 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[(Z)-1-(3,4-dichlorophenyl)ethylideneamino]-2-(4-methoxyanilino)acetamide |
| SMILES | COc1ccc(NCC(=O)N/N=C(/C)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-11(12-3-8-15(18)16(19)9-12)21-22-17(23)10-20-13-4-6-14(24-2)7-5-13/h3-9,20H,10H2,1-2H3,(H,22,23)/b21-11- |
| InChIKey | YIAOIBKZHGWAJV-NHDPSOOVSA-N |
| XLogP | 3.95 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|