C24H26Cl4N4O2 — CID 3439287
N,N'-bis[1-(3,4-dichlorophenyl)ethylideneamino]octanediamide (PubChem CID 3439287) has the molecular formula C24H26Cl4N4O2 and a molecular weight of 544.31 g/mol. Its IUPAC name is N,N'-bis[1-(3,4-dichlorophenyl)ethylideneamino]octanediamide.
| Compound Name | N,N'-bis[1-(3,4-dichlorophenyl)ethylideneamino]octanediamide |
|---|---|
| PubChem CID | 3439287 |
| Molecular Formula | C24H26Cl4N4O2 |
| Molecular Weight | 544.31 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | N,N'-bis[1-(3,4-dichlorophenyl)ethylideneamino]octanediamide |
| SMILES | CC(=NNC(=O)CCCCCCC(=O)NN=C(C)c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H26Cl4N4O2/c1-15(17-9-11-19(25)21(27)13-17)29-31-23(33)7-5-3-4-6-8-24(34)32-30-16(2)18-10-12-20(26)22(28)14-18/h9-14H,3-8H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | BMZMUSXZXSBCLM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.31 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|