C28H38N4O6 — CID 5058567
N,N'-bis[1-(3,4-dimethoxyphenyl)ethylideneamino]octanediamide (PubChem CID 5058567) has the molecular formula C28H38N4O6 and a molecular weight of 526.63 g/mol. Its IUPAC name is N,N'-bis[1-(3,4-dimethoxyphenyl)ethylideneamino]octanediamide.
| Compound Name | N,N'-bis[1-(3,4-dimethoxyphenyl)ethylideneamino]octanediamide |
|---|---|
| PubChem CID | 5058567 |
| Molecular Formula | C28H38N4O6 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | N,N'-bis[1-(3,4-dimethoxyphenyl)ethylideneamino]octanediamide |
| SMILES | COc1ccc(C(C)=NNC(=O)CCCCCCC(=O)NN=C(C)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C28H38N4O6/c1-19(21-13-15-23(35-3)25(17-21)37-5)29-31-27(33)11-9-7-8-10-12-28(34)32-30-20(2)22-14-16-24(36-4)26(18-22)38-6/h13-18H,7-12H2,1-6H3,(H,31,33)(H,32,34) |
| InChIKey | HELORDDUVKKBGF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|