C9H9Cl2N3O — CID 5495611
[(E)-1-(3,4-dichlorophenyl)ethylideneamino]urea (PubChem CID 5495611) has the molecular formula C9H9Cl2N3O and a molecular weight of 246.10 g/mol. Its IUPAC name is [(E)-1-(3,4-dichlorophenyl)ethylideneamino]urea.
| Compound Name | [(E)-1-(3,4-dichlorophenyl)ethylideneamino]urea |
|---|---|
| PubChem CID | 5495611 |
| Molecular Formula | C9H9Cl2N3O |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | [(E)-1-(3,4-dichlorophenyl)ethylideneamino]urea |
| SMILES | C/C(=N\NC(N)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2N3O/c1-5(13-14-9(12)15)6-2-3-7(10)8(11)4-6/h2-4H,1H3,(H3,12,14,15)/b13-5+ |
| InChIKey | RNPCDQNIIZVNNZ-WLRTZDKTSA-N |
| XLogP | 2.39 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|