C16H12Cl2N6O — CID 46804642
N-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-4-(tetrazol-1-yl)benzamide (PubChem CID 46804642) has the molecular formula C16H12Cl2N6O and a molecular weight of 375.22 g/mol. Its IUPAC name is N-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-4-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 46804642 |
| Molecular Formula | C16H12Cl2N6O |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]-4-(tetrazol-1-yl)benzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(-n2cnnn2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N6O/c1-10(12-4-7-14(17)15(18)8-12)20-21-16(25)11-2-5-13(6-3-11)24-9-19-22-23-24/h2-9H,1H3,(H,21,25)/b20-10+ |
| InChIKey | APEZRLICXACCNU-KEBDBYFISA-N |
| XLogP | 3.12 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|