C16H14N6O2 — CID 9072699
4-hydroxy-N-[(Z)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]benzamide (PubChem CID 9072699) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 4-hydroxy-N-[(Z)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]benzamide.
| Compound Name | 4-hydroxy-N-[(Z)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 9072699 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-hydroxy-N-[(Z)-1-[3-(tetrazol-1-yl)phenyl]ethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(O)cc1)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C16H14N6O2/c1-11(18-19-16(24)12-5-7-15(23)8-6-12)13-3-2-4-14(9-13)22-10-17-20-21-22/h2-10,23H,1H3,(H,19,24)/b18-11- |
| InChIKey | PBTRAKJTLZPIKE-WQRHYEAKSA-N |
| XLogP | 1.52 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|