C16H12N8O5 — CID 44726593
3,5-dinitro-N-[(E)-1-[4-(tetrazol-1-yl)phenyl]ethylideneamino]benzamide (PubChem CID 44726593) has the molecular formula C16H12N8O5 and a molecular weight of 396.32 g/mol. Its IUPAC name is 3,5-dinitro-N-[(E)-1-[4-(tetrazol-1-yl)phenyl]ethylideneamino]benzamide.
| Compound Name | 3,5-dinitro-N-[(E)-1-[4-(tetrazol-1-yl)phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 44726593 |
| Molecular Formula | C16H12N8O5 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 3,5-dinitro-N-[(E)-1-[4-(tetrazol-1-yl)phenyl]ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C16H12N8O5/c1-10(11-2-4-13(5-3-11)22-9-17-20-21-22)18-19-16(25)12-6-14(23(26)27)8-15(7-12)24(28)29/h2-9H,1H3,(H,19,25)/b18-10+ |
| InChIKey | KZPXFZHNMPVVTD-VCHYOVAHSA-N |
| XLogP | 1.63 |
| TPSA | 171.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|