C16H17N9O3 — CID 44726903
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(E)-1-[4-(tetrazol-1-yl)phenyl]ethylideneamino]acetamide (PubChem CID 44726903) has the molecular formula C16H17N9O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(E)-1-[4-(tetrazol-1-yl)phenyl]ethylideneamino]acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(E)-1-[4-(tetrazol-1-yl)phenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 44726903 |
| Molecular Formula | C16H17N9O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(E)-1-[4-(tetrazol-1-yl)phenyl]ethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)Cn1nc(C)c([N+](=O)[O-])c1C)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C16H17N9O3/c1-10(13-4-6-14(7-5-13)24-9-17-21-22-24)18-19-15(26)8-23-12(3)16(25(27)28)11(2)20-23/h4-7,9H,8H2,1-3H3,(H,19,26)/b18-10+ |
| InChIKey | ZUDINJLLQVIEIN-VCHYOVAHSA-N |
| XLogP | 0.92 |
| TPSA | 146.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|