C23H23N5O6 — CID 19659820
[4-[(E)-N-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] 3-methoxybenzoate (PubChem CID 19659820) has the molecular formula C23H23N5O6 and a molecular weight of 465.47 g/mol. Its IUPAC name is [4-[(E)-N-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] 3-methoxybenzoate.
| Compound Name | [4-[(E)-N-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 19659820 |
| Molecular Formula | C23H23N5O6 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | [4-[(E)-N-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(/C(C)=N/NC(=O)Cn3nc(C)c([N+](=O)[O-])c3C)cc2)c1 |
| InChI | InChI=1S/C23H23N5O6/c1-14(24-25-21(29)13-27-16(3)22(28(31)32)15(2)26-27)17-8-10-19(11-9-17)34-23(30)18-6-5-7-20(12-18)33-4/h5-12H,13H2,1-4H3,(H,25,29)/b24-14+ |
| InChIKey | IFHHMABNNXABQW-ZVHZXABRSA-N |
| XLogP | 3.18 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|