C23H23Cl2N5O5 — CID 19661517
N-[(E)-1-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 19661517) has the molecular formula C23H23Cl2N5O5 and a molecular weight of 520.37 g/mol. Its IUPAC name is N-[(E)-1-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[(E)-1-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19661517 |
| Molecular Formula | C23H23Cl2N5O5 |
| Molecular Weight | 520.37 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | N-[(E)-1-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | COc1cc(/C(C)=N/NC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H23Cl2N5O5/c1-13(26-27-22(31)11-29-15(3)23(30(32)33)14(2)28-29)16-8-9-20(21(10-16)34-4)35-12-17-18(24)6-5-7-19(17)25/h5-10H,11-12H2,1-4H3,(H,27,31)/b26-13+ |
| InChIKey | OSEKOGQMDQSUQE-LGJNPRDNSA-N |
| XLogP | 4.84 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|